C17H19FN4S — CID 169360064
[4-[4-(2-fluorophenyl)piperazin-1-yl]phenyl]thiourea (PubChem CID 169360064) has the molecular formula C17H19FN4S and a molecular weight of 330.43 g/mol. Its IUPAC name is [4-[4-(2-fluorophenyl)piperazin-1-yl]phenyl]thiourea.
| Compound Name | [4-[4-(2-fluorophenyl)piperazin-1-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 169360064 |
| Molecular Formula | C17H19FN4S |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [4-[4-(2-fluorophenyl)piperazin-1-yl]phenyl]thiourea |
| SMILES | NC(=S)Nc1ccc(N2CCN(c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C17H19FN4S/c18-15-3-1-2-4-16(15)22-11-9-21(10-12-22)14-7-5-13(6-8-14)20-17(19)23/h1-8H,9-12H2,(H3,19,20,23) |
| InChIKey | DATKKTAPFJJADM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|