C14H23N7 — CID 168603102
1-(diaminomethylidene)-2-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]guanidine (PubChem CID 168603102) has the molecular formula C14H23N7 and a molecular weight of 289.39 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 168603102 |
| Molecular Formula | C14H23N7 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]guanidine |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C14H23N7/c1-10-9-11(21-7-5-20(2)6-8-21)3-4-12(10)18-14(17)19-13(15)16/h3-4,9H,5-8H2,1-2H3,(H6,15,16,17,18,19) |
| InChIKey | MTHDPCONLHIZIH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|