C15H24N6O — CID 168604836
1-(diaminomethylidene)-2-[2-methoxy-4-(4-methylpiperidin-1-yl)phenyl]guanidine (PubChem CID 168604836) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-methoxy-4-(4-methylpiperidin-1-yl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-methoxy-4-(4-methylpiperidin-1-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 168604836 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-methoxy-4-(4-methylpiperidin-1-yl)phenyl]guanidine |
| SMILES | COc1cc(N2CCC(C)CC2)ccc1/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C15H24N6O/c1-10-5-7-21(8-6-10)11-3-4-12(13(9-11)22-2)19-15(18)20-14(16)17/h3-4,9-10H,5-8H2,1-2H3,(H6,16,17,18,19,20) |
| InChIKey | XPTKODQQPYFNLX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|