C15H22N6O2 — CID 168601780
3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-(4-methylpiperidin-1-yl)benzoic acid (PubChem CID 168601780) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-(4-methylpiperidin-1-yl)benzoic acid.
| Compound Name | 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-(4-methylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 168601780 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-(4-methylpiperidin-1-yl)benzoic acid |
| SMILES | CC1CCN(c2ccc(C(=O)O)cc2/N=C(\N)N=C(N)N)CC1 |
| InChI | InChI=1S/C15H22N6O2/c1-9-4-6-21(7-5-9)12-3-2-10(13(22)23)8-11(12)19-15(18)20-14(16)17/h2-3,8-9H,4-7H2,1H3,(H,22,23)(H6,16,17,18,19,20) |
| InChIKey | QSKCLEVJXQLKHQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 143.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|