C20H23FN2O3 — CID 67327205
4-[[4-[(4-fluorophenyl)methoxymethyl]phenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 67327205) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is 4-[[4-[(4-fluorophenyl)methoxymethyl]phenyl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[4-[(4-fluorophenyl)methoxymethyl]phenyl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 67327205 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 4-[[4-[(4-fluorophenyl)methoxymethyl]phenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(Cc2ccc(COCc3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C20H23FN2O3/c21-19-7-5-18(6-8-19)15-26-14-17-3-1-16(2-4-17)13-22-9-11-23(12-10-22)20(24)25/h1-8H,9-15H2,(H,24,25) |
| InChIKey | ANJJPMSTSQBEHX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |