C22H25N3O2 — CID 139599021
[4-[[4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1,4-diazepan-1-yl]-(5-methyl-3-pyridinyl)methanone (PubChem CID 139599021) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is [4-[[4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1,4-diazepan-1-yl]-(5-methyl-3-pyridinyl)methanone.
| Compound Name | [4-[[4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1,4-diazepan-1-yl]-(5-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 139599021 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | [4-[[4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1,4-diazepan-1-yl]-(5-methyl-3-pyridinyl)methanone |
| SMILES | Cc1cncc(C(=O)N2CCCN(Cc3ccc(C#CCO)cc3)CC2)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-18-14-21(16-23-15-18)22(27)25-10-3-9-24(11-12-25)17-20-7-5-19(6-8-20)4-2-13-26/h5-8,14-16,26H,3,9-13,17H2,1H3 |
| InChIKey | FDFNDDMEDQKBGR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|