C17H22F3NO3 — CID 120953620
2-[1-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]azepan-4-yl]acetic acid (PubChem CID 120953620) has the molecular formula C17H22F3NO3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-[1-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]azepan-4-yl]acetic acid.
| Compound Name | 2-[1-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]azepan-4-yl]acetic acid |
|---|---|
| PubChem CID | 120953620 |
| Molecular Formula | C17H22F3NO3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-[1-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]azepan-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN(Cc2cccc(OCC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H22F3NO3/c18-17(19,20)12-24-15-5-1-3-14(9-15)11-21-7-2-4-13(6-8-21)10-16(22)23/h1,3,5,9,13H,2,4,6-8,10-12H2,(H,22,23) |
| InChIKey | ZRAUEYZYRKNBBH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |