C18H20FNO4S — CID 53089852
1-(4-ethoxyphenyl)sulfonyl-3-[(3-fluorophenyl)methoxy]azetidine (PubChem CID 53089852) has the molecular formula C18H20FNO4S and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)sulfonyl-3-[(3-fluorophenyl)methoxy]azetidine.
| Compound Name | 1-(4-ethoxyphenyl)sulfonyl-3-[(3-fluorophenyl)methoxy]azetidine |
|---|---|
| PubChem CID | 53089852 |
| Molecular Formula | C18H20FNO4S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 1-(4-ethoxyphenyl)sulfonyl-3-[(3-fluorophenyl)methoxy]azetidine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CC(OCc3cccc(F)c3)C2)cc1 |
| InChI | InChI=1S/C18H20FNO4S/c1-2-23-16-6-8-18(9-7-16)25(21,22)20-11-17(12-20)24-13-14-4-3-5-15(19)10-14/h3-10,17H,2,11-13H2,1H3 |
| InChIKey | QSIVBNKDPDXYBU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |