C15H19F3N2O2S — CID 119987863
N-(cyclopropylmethyl)-1-(3,4,5-trifluorophenyl)sulfonylpiperidin-4-amine (PubChem CID 119987863) has the molecular formula C15H19F3N2O2S and a molecular weight of 348.39 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-(3,4,5-trifluorophenyl)sulfonylpiperidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-1-(3,4,5-trifluorophenyl)sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 119987863 |
| Molecular Formula | C15H19F3N2O2S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-(cyclopropylmethyl)-1-(3,4,5-trifluorophenyl)sulfonylpiperidin-4-amine |
| SMILES | O=S(=O)(c1cc(F)c(F)c(F)c1)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C15H19F3N2O2S/c16-13-7-12(8-14(17)15(13)18)23(21,22)20-5-3-11(4-6-20)19-9-10-1-2-10/h7-8,10-11,19H,1-6,9H2 |
| InChIKey | JOESTXKTHJWGQO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|