C14H23N3O2S — CID 115307191
N-(cyclopropylmethyl)-1-(1-methylpyrrol-3-yl)sulfonylpiperidin-4-amine (PubChem CID 115307191) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-(1-methylpyrrol-3-yl)sulfonylpiperidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-1-(1-methylpyrrol-3-yl)sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 115307191 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(cyclopropylmethyl)-1-(1-methylpyrrol-3-yl)sulfonylpiperidin-4-amine |
| SMILES | Cn1ccc(S(=O)(=O)N2CCC(NCC3CC3)CC2)c1 |
| InChI | InChI=1S/C14H23N3O2S/c1-16-7-6-14(11-16)20(18,19)17-8-4-13(5-9-17)15-10-12-2-3-12/h6-7,11-13,15H,2-5,8-10H2,1H3 |
| InChIKey | AYWJFVRMJWACCR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |