C12H18N2O5S2 — CID 129325414
3-[(3S)-1-(2-methylsulfonylethylsulfonyl)pyrrolidin-3-yl]oxypyridine (PubChem CID 129325414) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-[(3S)-1-(2-methylsulfonylethylsulfonyl)pyrrolidin-3-yl]oxypyridine.
| Compound Name | 3-[(3S)-1-(2-methylsulfonylethylsulfonyl)pyrrolidin-3-yl]oxypyridine |
|---|---|
| PubChem CID | 129325414 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-[(3S)-1-(2-methylsulfonylethylsulfonyl)pyrrolidin-3-yl]oxypyridine |
| SMILES | CS(=O)(=O)CCS(=O)(=O)N1CC[C@H](Oc2cccnc2)C1 |
| InChI | InChI=1S/C12H18N2O5S2/c1-20(15,16)7-8-21(17,18)14-6-4-12(10-14)19-11-3-2-5-13-9-11/h2-3,5,9,12H,4,6-8,10H2,1H3/t12-/m0/s1 |
| InChIKey | ADMYBOSPTWKXBJ-LBPRGKRZSA-N |
| XLogP | -0.09 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |