C13H21N3O4S — CID 129425283
(3R)-N-(2-methoxyethyl)-N-methyl-3-pyridin-3-yloxypyrrolidine-1-sulfonamide (PubChem CID 129425283) has the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. Its IUPAC name is (3R)-N-(2-methoxyethyl)-N-methyl-3-pyridin-3-yloxypyrrolidine-1-sulfonamide.
| Compound Name | (3R)-N-(2-methoxyethyl)-N-methyl-3-pyridin-3-yloxypyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 129425283 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (3R)-N-(2-methoxyethyl)-N-methyl-3-pyridin-3-yloxypyrrolidine-1-sulfonamide |
| SMILES | COCCN(C)S(=O)(=O)N1CC[C@@H](Oc2cccnc2)C1 |
| InChI | InChI=1S/C13H21N3O4S/c1-15(8-9-19-2)21(17,18)16-7-5-13(11-16)20-12-4-3-6-14-10-12/h3-4,6,10,13H,5,7-9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | LGOHQACEYLOWGI-CYBMUJFWSA-N |
| XLogP | 0.36 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |