C13H19N3O4S — CID 75495327
4-(3-pyridin-3-yloxypyrrolidin-1-yl)sulfonylmorpholine (PubChem CID 75495327) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-(3-pyridin-3-yloxypyrrolidin-1-yl)sulfonylmorpholine.
| Compound Name | 4-(3-pyridin-3-yloxypyrrolidin-1-yl)sulfonylmorpholine |
|---|---|
| PubChem CID | 75495327 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-(3-pyridin-3-yloxypyrrolidin-1-yl)sulfonylmorpholine |
| SMILES | O=S(=O)(N1CCOCC1)N1CCC(Oc2cccnc2)C1 |
| InChI | InChI=1S/C13H19N3O4S/c17-21(18,15-6-8-19-9-7-15)16-5-3-13(11-16)20-12-2-1-4-14-10-12/h1-2,4,10,13H,3,5-9,11H2 |
| InChIKey | MOVNHQXTDXVKTI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |