C18H22N4O4S — CID 118675921
4-[3-[(2-pyridin-4-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]sulfonylmorpholine (PubChem CID 118675921) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is 4-[3-[(2-pyridin-4-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]sulfonylmorpholine.
| Compound Name | 4-[3-[(2-pyridin-4-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 118675921 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 4-[3-[(2-pyridin-4-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]sulfonylmorpholine |
| SMILES | O=S(=O)(N1CCOCC1)N1CCC(Oc2cccnc2-c2ccncc2)C1 |
| InChI | InChI=1S/C18H22N4O4S/c23-27(24,21-10-12-25-13-11-21)22-9-5-16(14-22)26-17-2-1-6-20-18(17)15-3-7-19-8-4-15/h1-4,6-8,16H,5,9-14H2 |
| InChIKey | BGQMNXLNKJOQGH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |