C18H25N3O4S — CID 126951892
4-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]sulfonylmorpholine (PubChem CID 126951892) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]sulfonylmorpholine.
| Compound Name | 4-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 126951892 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]sulfonylmorpholine |
| SMILES | Cn1ccc2c(OC3CCN(S(=O)(=O)N4CCOCC4)CC3)cccc21 |
| InChI | InChI=1S/C18H25N3O4S/c1-19-8-7-16-17(19)3-2-4-18(16)25-15-5-9-20(10-6-15)26(22,23)21-11-13-24-14-12-21/h2-4,7-8,15H,5-6,9-14H2,1H3 |
| InChIKey | BCUMZWGQYPJTLX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |