C21H21N5O2 — CID 126951864
2H-benzotriazol-5-yl-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]methanone (PubChem CID 126951864) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2H-benzotriazol-5-yl-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]methanone.
| Compound Name | 2H-benzotriazol-5-yl-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 126951864 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2H-benzotriazol-5-yl-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]methanone |
| SMILES | Cn1ccc2c(OC3CCN(C(=O)c4ccc5n[nH]nc5c4)CC3)cccc21 |
| InChI | InChI=1S/C21H21N5O2/c1-25-10-9-16-19(25)3-2-4-20(16)28-15-7-11-26(12-8-15)21(27)14-5-6-17-18(13-14)23-24-22-17/h2-6,9-10,13,15H,7-8,11-12H2,1H3,(H,22,23,24) |
| InChIKey | RKRJDIZXRLJACA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |