C16H18N4OS — CID 126951949
3-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]-1,2,5-thiadiazole (PubChem CID 126951949) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]-1,2,5-thiadiazole.
| Compound Name | 3-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 126951949 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]-1,2,5-thiadiazole |
| SMILES | Cn1ccc2c(OC3CCN(c4cnsn4)CC3)cccc21 |
| InChI | InChI=1S/C16H18N4OS/c1-19-8-7-13-14(19)3-2-4-15(13)21-12-5-9-20(10-6-12)16-11-17-22-18-16/h2-4,7-8,11-12H,5-6,9-10H2,1H3 |
| InChIKey | UBFAJCYSQBJISD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |