C19H24N4O3S — CID 126951893
4-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]oxy-1-methylindole (PubChem CID 126951893) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is 4-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]oxy-1-methylindole.
| Compound Name | 4-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]oxy-1-methylindole |
|---|---|
| PubChem CID | 126951893 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]oxy-1-methylindole |
| SMILES | Cc1nc(S(=O)(=O)N2CCC(Oc3cccc4c3ccn4C)CC2)cn1C |
| InChI | InChI=1S/C19H24N4O3S/c1-14-20-19(13-22(14)3)27(24,25)23-11-7-15(8-12-23)26-18-6-4-5-17-16(18)9-10-21(17)2/h4-6,9-10,13,15H,7-8,11-12H2,1-3H3 |
| InChIKey | HDYCPGNUFAUJDF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |