C17H23N3O3S — CID 97239217
(S)-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-phenylmethanol (PubChem CID 97239217) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is (S)-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-phenylmethanol.
| Compound Name | (S)-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-phenylmethanol |
|---|---|
| PubChem CID | 97239217 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (S)-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-phenylmethanol |
| SMILES | Cc1nc(S(=O)(=O)N2CCC([C@H](O)c3ccccc3)CC2)cn1C |
| InChI | InChI=1S/C17H23N3O3S/c1-13-18-16(12-19(13)2)24(22,23)20-10-8-15(9-11-20)17(21)14-6-4-3-5-7-14/h3-7,12,15,17,21H,8-11H2,1-2H3/t17-/m1/s1 |
| InChIKey | YNXIDRSCSMLZAX-QGZVFWFLSA-N |
| XLogP | 1.86 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |