C12H20BrN3O2S — CID 106839595
4-(1-bromoethyl)-1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine (PubChem CID 106839595) has the molecular formula C12H20BrN3O2S and a molecular weight of 350.28 g/mol. Its IUPAC name is 4-(1-bromoethyl)-1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine.
| Compound Name | 4-(1-bromoethyl)-1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 106839595 |
| Molecular Formula | C12H20BrN3O2S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 4-(1-bromoethyl)-1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine |
| SMILES | Cc1nc(S(=O)(=O)N2CCC(C(C)Br)CC2)cn1C |
| InChI | InChI=1S/C12H20BrN3O2S/c1-9(13)11-4-6-16(7-5-11)19(17,18)12-8-15(3)10(2)14-12/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | FJTMCHZNRKUJEC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|