C17H23N3O4S2 — CID 121022794
4-benzylsulfonyl-1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine (PubChem CID 121022794) has the molecular formula C17H23N3O4S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-benzylsulfonyl-1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine.
| Compound Name | 4-benzylsulfonyl-1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 121022794 |
| Molecular Formula | C17H23N3O4S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 4-benzylsulfonyl-1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine |
| SMILES | Cc1nc(S(=O)(=O)N2CCC(S(=O)(=O)Cc3ccccc3)CC2)cn1C |
| InChI | InChI=1S/C17H23N3O4S2/c1-14-18-17(12-19(14)2)26(23,24)20-10-8-16(9-11-20)25(21,22)13-15-6-4-3-5-7-15/h3-7,12,16H,8-11,13H2,1-2H3 |
| InChIKey | AIAZTEMBCUUDKC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |