About 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one
1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 68529557) has the molecular formula C18H22N4O4S
and a molecular weight of 390.47 g/mol. Its IUPAC name is 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one.
Molecular Properties
| Compound Name | 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| PubChem CID | 68529557 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | Cc1nc(S(=O)(=O)N2CCC(N3C(=O)OCc4ccccc43)CC2)cn1C |
| InChI | InChI=1S/C18H22N4O4S/c1-13-19-17(11-20(13)2)27(24,25)21-9-7-15(8-10-21)22-16-6-4-3-5-14(16)12-26-18(22)23/h3-6,11,15H,7-10,12H2,1-2H3 |
| InChIKey | ABZYKKZRQPOKNS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one?
The IUPAC name of 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one (CID 68529557) is 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one.
What is the SMILES notation for 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one?
The canonical SMILES for 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one is Cc1nc(S(=O)(=O)N2CCC(N3C(=O)OCc4ccccc43)CC2)cn1C.
What is the InChIKey of 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one?
The InChIKey is ABZYKKZRQPOKNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O4S/c1-13-19-17(11-20(13)2)27(24,25)21-9-7-15(8-10-21)22-16-6-4-3-5-14(16)12-26-18(22)23/h3-6,11,15H,7-10,12H2,1-2H3.
What are the key properties of 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one?
1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one has a molecular weight of 390.47 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one is sourced from PubChem (CID 68529557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).