C21H21N3O5S — CID 126951964
5-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]sulfonyl-3H-1,3-benzoxazol-2-one (PubChem CID 126951964) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 5-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]sulfonyl-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]sulfonyl-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 126951964 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 5-[4-(1-methylindol-4-yl)oxypiperidin-1-yl]sulfonyl-3H-1,3-benzoxazol-2-one |
| SMILES | Cn1ccc2c(OC3CCN(S(=O)(=O)c4ccc5oc(=O)[nH]c5c4)CC3)cccc21 |
| InChI | InChI=1S/C21H21N3O5S/c1-23-10-9-16-18(23)3-2-4-19(16)28-14-7-11-24(12-8-14)30(26,27)15-5-6-20-17(13-15)22-21(25)29-20/h2-6,9-10,13-14H,7-8,11-12H2,1H3,(H,22,25) |
| InChIKey | KZWROOVBNUGLIU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |