C16H21N3O2S — CID 124684923
N-methyl-1-[(3R)-1-(3-methylquinolin-8-yl)sulfonylpyrrolidin-3-yl]methanamine (PubChem CID 124684923) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-methyl-1-[(3R)-1-(3-methylquinolin-8-yl)sulfonylpyrrolidin-3-yl]methanamine.
| Compound Name | N-methyl-1-[(3R)-1-(3-methylquinolin-8-yl)sulfonylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 124684923 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-methyl-1-[(3R)-1-(3-methylquinolin-8-yl)sulfonylpyrrolidin-3-yl]methanamine |
| SMILES | CNC[C@H]1CCN(S(=O)(=O)c2cccc3cc(C)cnc23)C1 |
| InChI | InChI=1S/C16H21N3O2S/c1-12-8-14-4-3-5-15(16(14)18-9-12)22(20,21)19-7-6-13(11-19)10-17-2/h3-5,8-9,13,17H,6-7,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | PJBUJUIEBVYJPX-CYBMUJFWSA-N |
| XLogP | 1.77 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |