C16H20N2O3S — CID 110892063
[1-(3-methylquinolin-8-yl)sulfonylpiperidin-3-yl]methanol (PubChem CID 110892063) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is [1-(3-methylquinolin-8-yl)sulfonylpiperidin-3-yl]methanol.
| Compound Name | [1-(3-methylquinolin-8-yl)sulfonylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 110892063 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [1-(3-methylquinolin-8-yl)sulfonylpiperidin-3-yl]methanol |
| SMILES | Cc1cnc2c(S(=O)(=O)N3CCCC(CO)C3)cccc2c1 |
| InChI | InChI=1S/C16H20N2O3S/c1-12-8-14-5-2-6-15(16(14)17-9-12)22(20,21)18-7-3-4-13(10-18)11-19/h2,5-6,8-9,13,19H,3-4,7,10-11H2,1H3 |
| InChIKey | NHJOHFPWVCDNHE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |