C14H17F3N2O4S — CID 97003316
(3S)-1-(4,5-dimethyl-2-nitrophenyl)sulfonyl-3-(trifluoromethyl)piperidine (PubChem CID 97003316) has the molecular formula C14H17F3N2O4S and a molecular weight of 366.36 g/mol. Its IUPAC name is (3S)-1-(4,5-dimethyl-2-nitrophenyl)sulfonyl-3-(trifluoromethyl)piperidine.
| Compound Name | (3S)-1-(4,5-dimethyl-2-nitrophenyl)sulfonyl-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 97003316 |
| Molecular Formula | C14H17F3N2O4S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (3S)-1-(4,5-dimethyl-2-nitrophenyl)sulfonyl-3-(trifluoromethyl)piperidine |
| SMILES | Cc1cc([N+](=O)[O-])c(S(=O)(=O)N2CCC[C@H](C(F)(F)F)C2)cc1C |
| InChI | InChI=1S/C14H17F3N2O4S/c1-9-6-12(19(20)21)13(7-10(9)2)24(22,23)18-5-3-4-11(8-18)14(15,16)17/h6-7,11H,3-5,8H2,1-2H3/t11-/m0/s1 |
| InChIKey | XFSARGUILJPVIA-NSHDSACASA-N |
| XLogP | 3.17 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|