C15H23N3O4S — CID 119984339
1-[1-(4,5-dimethyl-2-nitrophenyl)sulfonylpiperidin-3-yl]ethanamine (PubChem CID 119984339) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is 1-[1-(4,5-dimethyl-2-nitrophenyl)sulfonylpiperidin-3-yl]ethanamine.
| Compound Name | 1-[1-(4,5-dimethyl-2-nitrophenyl)sulfonylpiperidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 119984339 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-[1-(4,5-dimethyl-2-nitrophenyl)sulfonylpiperidin-3-yl]ethanamine |
| SMILES | Cc1cc([N+](=O)[O-])c(S(=O)(=O)N2CCCC(C(C)N)C2)cc1C |
| InChI | InChI=1S/C15H23N3O4S/c1-10-7-14(18(19)20)15(8-11(10)2)23(21,22)17-6-4-5-13(9-17)12(3)16/h7-8,12-13H,4-6,9,16H2,1-3H3 |
| InChIKey | FUDBZIJFQHWXEM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|