C11H12F4N2O2S — CID 103299373
3-fluoro-2-[3-(trifluoromethyl)piperidin-1-yl]sulfonylpyridine (PubChem CID 103299373) has the molecular formula C11H12F4N2O2S and a molecular weight of 312.29 g/mol. Its IUPAC name is 3-fluoro-2-[3-(trifluoromethyl)piperidin-1-yl]sulfonylpyridine.
| Compound Name | 3-fluoro-2-[3-(trifluoromethyl)piperidin-1-yl]sulfonylpyridine |
|---|---|
| PubChem CID | 103299373 |
| Molecular Formula | C11H12F4N2O2S |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-fluoro-2-[3-(trifluoromethyl)piperidin-1-yl]sulfonylpyridine |
| SMILES | O=S(=O)(c1ncccc1F)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H12F4N2O2S/c12-9-4-1-5-16-10(9)20(18,19)17-6-2-3-8(7-17)11(13,14)15/h1,4-5,8H,2-3,6-7H2 |
| InChIKey | MZTFVLDUGPFIBB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |