C12H18FN3O2S — CID 103298431
3-ethyl-1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-4-amine (PubChem CID 103298431) has the molecular formula C12H18FN3O2S and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-ethyl-1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-4-amine.
| Compound Name | 3-ethyl-1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-4-amine |
|---|---|
| PubChem CID | 103298431 |
| Molecular Formula | C12H18FN3O2S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-ethyl-1-[(3-fluoro-2-pyridinyl)sulfonyl]piperidin-4-amine |
| SMILES | CCC1CN(S(=O)(=O)c2ncccc2F)CCC1N |
| InChI | InChI=1S/C12H18FN3O2S/c1-2-9-8-16(7-5-11(9)14)19(17,18)12-10(13)4-3-6-15-12/h3-4,6,9,11H,2,5,7-8,14H2,1H3 |
| InChIKey | GGJCORVWQVIDOP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |