C13H22N4O2S — CID 105359185
4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-1,5-dimethylpyrazol-3-amine (PubChem CID 105359185) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-1,5-dimethylpyrazol-3-amine.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-1,5-dimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 105359185 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-1,5-dimethylpyrazol-3-amine |
| SMILES | Cc1c(S(=O)(=O)N2CCC3CCCCC32)c(N)nn1C |
| InChI | InChI=1S/C13H22N4O2S/c1-9-12(13(14)15-16(9)2)20(18,19)17-8-7-10-5-3-4-6-11(10)17/h10-11H,3-8H2,1-2H3,(H2,14,15) |
| InChIKey | IIZLWLDOKDPUES-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |