C11H17BrN4O2S — CID 106468138
1-(5-bromo-3-methyltriazol-4-yl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 106468138) has the molecular formula C11H17BrN4O2S and a molecular weight of 349.25 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 106468138 |
| Molecular Formula | C11H17BrN4O2S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)N1CCC2CCCCC21 |
| InChI | InChI=1S/C11H17BrN4O2S/c1-15-11(10(12)13-14-15)19(17,18)16-7-6-8-4-2-3-5-9(8)16/h8-9H,2-7H2,1H3 |
| InChIKey | XFRZZMHLYDGLAE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |