C9H14BrN5O2S2 — CID 106466551
1-(5-bromo-3-methyltriazol-4-yl)sulfonylpiperidine-3-carbothioamide (PubChem CID 106466551) has the molecular formula C9H14BrN5O2S2 and a molecular weight of 368.28 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)sulfonylpiperidine-3-carbothioamide.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)sulfonylpiperidine-3-carbothioamide |
|---|---|
| PubChem CID | 106466551 |
| Molecular Formula | C9H14BrN5O2S2 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)sulfonylpiperidine-3-carbothioamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)N1CCCC(C(N)=S)C1 |
| InChI | InChI=1S/C9H14BrN5O2S2/c1-14-9(7(10)12-13-14)19(16,17)15-4-2-3-6(5-15)8(11)18/h6H,2-5H2,1H3,(H2,11,18) |
| InChIKey | OYHMQTPKDOMGDO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|