C11H20BrN5O3S — CID 106467109
3-[1-(5-bromo-3-methyltriazol-4-yl)sulfonylpiperidin-4-yl]oxypropan-1-amine (PubChem CID 106467109) has the molecular formula C11H20BrN5O3S and a molecular weight of 382.28 g/mol. Its IUPAC name is 3-[1-(5-bromo-3-methyltriazol-4-yl)sulfonylpiperidin-4-yl]oxypropan-1-amine.
| Compound Name | 3-[1-(5-bromo-3-methyltriazol-4-yl)sulfonylpiperidin-4-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 106467109 |
| Molecular Formula | C11H20BrN5O3S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 3-[1-(5-bromo-3-methyltriazol-4-yl)sulfonylpiperidin-4-yl]oxypropan-1-amine |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)N1CCC(OCCCN)CC1 |
| InChI | InChI=1S/C11H20BrN5O3S/c1-16-11(10(12)14-15-16)21(18,19)17-6-3-9(4-7-17)20-8-2-5-13/h9H,2-8,13H2,1H3 |
| InChIKey | GMABHLSWGKZAGG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|