C13H24N4O3S — CID 79736699
3-[1-(1-ethylimidazol-4-yl)sulfonylpiperidin-4-yl]oxypropan-1-amine (PubChem CID 79736699) has the molecular formula C13H24N4O3S and a molecular weight of 316.43 g/mol. Its IUPAC name is 3-[1-(1-ethylimidazol-4-yl)sulfonylpiperidin-4-yl]oxypropan-1-amine.
| Compound Name | 3-[1-(1-ethylimidazol-4-yl)sulfonylpiperidin-4-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 79736699 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-[1-(1-ethylimidazol-4-yl)sulfonylpiperidin-4-yl]oxypropan-1-amine |
| SMILES | CCn1cnc(S(=O)(=O)N2CCC(OCCCN)CC2)c1 |
| InChI | InChI=1S/C13H24N4O3S/c1-2-16-10-13(15-11-16)21(18,19)17-7-4-12(5-8-17)20-9-3-6-14/h10-12H,2-9,14H2,1H3 |
| InChIKey | GQSIYSBXTIZLGH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|