C10H19ClN4O2S — CID 119959743
1-(1-ethylimidazol-4-yl)sulfonylpiperidin-3-amine;hydrochloride (PubChem CID 119959743) has the molecular formula C10H19ClN4O2S and a molecular weight of 294.81 g/mol. Its IUPAC name is 1-(1-ethylimidazol-4-yl)sulfonylpiperidin-3-amine;hydrochloride.
| Compound Name | 1-(1-ethylimidazol-4-yl)sulfonylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119959743 |
| Molecular Formula | C10H19ClN4O2S |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-(1-ethylimidazol-4-yl)sulfonylpiperidin-3-amine;hydrochloride |
| SMILES | CCn1cnc(S(=O)(=O)N2CCCC(N)C2)c1.Cl |
| InChI | InChI=1S/C10H18N4O2S.ClH/c1-2-13-7-10(12-8-13)17(15,16)14-5-3-4-9(11)6-14;/h7-9H,2-6,11H2,1H3;1H |
| InChIKey | DYUSQJUTNMTSME-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |