C9H15N3O3S — CID 79373473
1-(1-ethylimidazol-4-yl)sulfonylpyrrolidin-3-ol (PubChem CID 79373473) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is 1-(1-ethylimidazol-4-yl)sulfonylpyrrolidin-3-ol.
| Compound Name | 1-(1-ethylimidazol-4-yl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 79373473 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-(1-ethylimidazol-4-yl)sulfonylpyrrolidin-3-ol |
| SMILES | CCn1cnc(S(=O)(=O)N2CCC(O)C2)c1 |
| InChI | InChI=1S/C9H15N3O3S/c1-2-11-6-9(10-7-11)16(14,15)12-4-3-8(13)5-12/h6-8,13H,2-5H2,1H3 |
| InChIKey | RASCUMBKUSPLHP-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |