C12H23N5O2S — CID 105357945
1,5-dimethyl-4-(4-propylpiperazin-1-yl)sulfonylpyrazol-3-amine (PubChem CID 105357945) has the molecular formula C12H23N5O2S and a molecular weight of 301.42 g/mol. Its IUPAC name is 1,5-dimethyl-4-(4-propylpiperazin-1-yl)sulfonylpyrazol-3-amine.
| Compound Name | 1,5-dimethyl-4-(4-propylpiperazin-1-yl)sulfonylpyrazol-3-amine |
|---|---|
| PubChem CID | 105357945 |
| Molecular Formula | C12H23N5O2S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 1,5-dimethyl-4-(4-propylpiperazin-1-yl)sulfonylpyrazol-3-amine |
| SMILES | CCCN1CCN(S(=O)(=O)c2c(N)nn(C)c2C)CC1 |
| InChI | InChI=1S/C12H23N5O2S/c1-4-5-16-6-8-17(9-7-16)20(18,19)11-10(2)15(3)14-12(11)13/h4-9H2,1-3H3,(H2,13,14) |
| InChIKey | GOOPINYXMSEHRE-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |