C17H27N4O5S+ — CID 8553535
N-[(2R)-3-methylbutan-2-yl]-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 8553535) has the molecular formula C17H27N4O5S+ and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[(2R)-3-methylbutan-2-yl]-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[(2R)-3-methylbutan-2-yl]-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8553535 |
| Molecular Formula | C17H27N4O5S+ |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[(2R)-3-methylbutan-2-yl]-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | CC(C)[C@@H](C)NC(=O)C[NH+]1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H26N4O5S/c1-13(2)14(3)18-17(22)12-19-8-10-20(11-9-19)27(25,26)16-7-5-4-6-15(16)21(23)24/h4-7,13-14H,8-12H2,1-3H3,(H,18,22)/p+1/t14-/m1/s1 |
| InChIKey | VRJVNDPWKNTXSJ-CQSZACIVSA-O |
| XLogP | -0.36 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|