C20H22F2N3O4+ — CID 8015411
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8015411) has the molecular formula C20H22F2N3O4+ and a molecular weight of 406.41 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8015411 |
| Molecular Formula | C20H22F2N3O4+ |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1ccc(N2CC[NH+](CC(=O)Nc3ccc4c(c3)OC(F)(F)O4)CC2)cc1 |
| InChI | InChI=1S/C20H21F2N3O4/c1-27-16-5-3-15(4-6-16)25-10-8-24(9-11-25)13-19(26)23-14-2-7-17-18(12-14)29-20(21,22)28-17/h2-7,12H,8-11,13H2,1H3,(H,23,26)/p+1 |
| InChIKey | NWJFMDVTBBEUSR-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|