C24H33N4O3+ — CID 8587287
N,N-diethyl-4-[[2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzamide (PubChem CID 8587287) has the molecular formula C24H33N4O3+ and a molecular weight of 425.55 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzamide.
| Compound Name | N,N-diethyl-4-[[2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 8587287 |
| Molecular Formula | C24H33N4O3+ |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N,N-diethyl-4-[[2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)C[NH+]2CCN(c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H32N4O3/c1-4-27(5-2)24(30)19-6-8-20(9-7-19)25-23(29)18-26-14-16-28(17-15-26)21-10-12-22(31-3)13-11-21/h6-13H,4-5,14-18H2,1-3H3,(H,25,29)/p+1 |
| InChIKey | LYXWRNDCSMUGLZ-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|