C22H23N3O5 — CID 25161545
4-(2,5-dioxopyrrolidin-1-yl)-N-ethyl-N-[2-(4-methoxyanilino)-2-oxoethyl]benzamide (PubChem CID 25161545) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-ethyl-N-[2-(4-methoxyanilino)-2-oxoethyl]benzamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-ethyl-N-[2-(4-methoxyanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 25161545 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-ethyl-N-[2-(4-methoxyanilino)-2-oxoethyl]benzamide |
| SMILES | CCN(CC(=O)Nc1ccc(OC)cc1)C(=O)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C22H23N3O5/c1-3-24(14-19(26)23-16-6-10-18(30-2)11-7-16)22(29)15-4-8-17(9-5-15)25-20(27)12-13-21(25)28/h4-11H,3,12-14H2,1-2H3,(H,23,26) |
| InChIKey | KJEHNGDLPZDVQH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|