C15H23N3O3S3 — CID 3251537
[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] N,N-dimethylcarbamodithioate (PubChem CID 3251537) has the molecular formula C15H23N3O3S3 and a molecular weight of 389.57 g/mol. Its IUPAC name is [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 3251537 |
| Molecular Formula | C15H23N3O3S3 |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] N,N-dimethylcarbamodithioate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)CSC(=S)N(C)C)cc1 |
| InChI | InChI=1S/C15H23N3O3S3/c1-5-18(6-2)24(20,21)13-9-7-12(8-10-13)16-14(19)11-23-15(22)17(3)4/h7-10H,5-6,11H2,1-4H3,(H,16,19) |
| InChIKey | MWUJAYHSUVFDNP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|