C16H26N3O3S+ — CID 8901828
N-[4-(diethylsulfamoyl)phenyl]-2-pyrrolidin-1-ium-1-ylacetamide (PubChem CID 8901828) has the molecular formula C16H26N3O3S+ and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-pyrrolidin-1-ium-1-ylacetamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-pyrrolidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 8901828 |
| Molecular Formula | C16H26N3O3S+ |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-pyrrolidin-1-ium-1-ylacetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)C[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C16H25N3O3S/c1-3-19(4-2)23(21,22)15-9-7-14(8-10-15)17-16(20)13-18-11-5-6-12-18/h7-10H,3-6,11-13H2,1-2H3,(H,17,20)/p+1 |
| InChIKey | KQLIOBOFYZTCPL-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |