C18H29N4O4S+ — CID 7809321
1-[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl]piperidin-1-ium-4-carboxamide (PubChem CID 7809321) has the molecular formula C18H29N4O4S+ and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7809321 |
| Molecular Formula | C18H29N4O4S+ |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl]piperidin-1-ium-4-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)C[NH+]2CCC(C(N)=O)CC2)c1 |
| InChI | InChI=1S/C18H28N4O4S/c1-3-22(4-2)27(25,26)16-7-5-6-15(12-16)20-17(23)13-21-10-8-14(9-11-21)18(19)24/h5-7,12,14H,3-4,8-11,13H2,1-2H3,(H2,19,24)(H,20,23)/p+1 |
| InChIKey | LOFAIOUDHMWMGO-UHFFFAOYSA-O |
| XLogP | -0.56 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |