C18H27N3O5S — CID 122100893
2-[cyclopropyl-[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl]amino]propanoic acid (PubChem CID 122100893) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl]amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122100893 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-[cyclopropyl-[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl]amino]propanoic acid |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)CN(C2CC2)C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C18H27N3O5S/c1-4-20(5-2)27(25,26)16-10-6-14(7-11-16)19-17(22)12-21(15-8-9-15)13(3)18(23)24/h6-7,10-11,13,15H,4-5,8-9,12H2,1-3H3,(H,19,22)(H,23,24) |
| InChIKey | HIAKYMZBLHEHNN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |