C15H18F2N2O5S — CID 122100767
2-[cyclopropyl-[2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethyl]amino]propanoic acid (PubChem CID 122100767) has the molecular formula C15H18F2N2O5S and a molecular weight of 376.38 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethyl]amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-[2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122100767 |
| Molecular Formula | C15H18F2N2O5S |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[cyclopropyl-[2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(CC(=O)Nc1ccc(S(=O)(=O)C(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C15H18F2N2O5S/c1-9(14(21)22)19(11-4-5-11)8-13(20)18-10-2-6-12(7-3-10)25(23,24)15(16)17/h2-3,6-7,9,11,15H,4-5,8H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | PFNHQZMOIMXGIB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |