C13H14F2N2OS2 — CID 7607052
[2-(2,4-difluoroanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 7607052) has the molecular formula C13H14F2N2OS2 and a molecular weight of 316.40 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7607052 |
| Molecular Formula | C13H14F2N2OS2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCC1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H14F2N2OS2/c14-9-3-4-11(10(15)7-9)16-12(18)8-20-13(19)17-5-1-2-6-17/h3-4,7H,1-2,5-6,8H2,(H,16,18) |
| InChIKey | SDHLVRKAYBHTHU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|