C13H14N4OS3 — CID 30688622
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 30688622) has the molecular formula C13H14N4OS3 and a molecular weight of 338.48 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 30688622 |
| Molecular Formula | C13H14N4OS3 |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCC1)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C13H14N4OS3/c18-11(8-20-13(19)17-6-1-2-7-17)14-9-4-3-5-10-12(9)16-21-15-10/h3-5H,1-2,6-8H2,(H,14,18) |
| InChIKey | LJYIOMDZBLCXMY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|