C20H29N3OS2 — CID 9032922
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 4-methylpiperidine-1-carbodithioate (PubChem CID 9032922) has the molecular formula C20H29N3OS2 and a molecular weight of 391.61 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 4-methylpiperidine-1-carbodithioate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 4-methylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 9032922 |
| Molecular Formula | C20H29N3OS2 |
| Molecular Weight | 391.61 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 4-methylpiperidine-1-carbodithioate |
| SMILES | CC1CCN(C(=S)SCC(=O)Nc2ccc(N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C20H29N3OS2/c1-16-9-13-23(14-10-16)20(25)26-15-19(24)21-17-5-7-18(8-6-17)22-11-3-2-4-12-22/h5-8,16H,2-4,9-15H2,1H3,(H,21,24) |
| InChIKey | COQRMRXVMNHKIW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|