C13H17ClN4OS2 — CID 9456891
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-methylpiperazine-1-carbodithioate (PubChem CID 9456891) has the molecular formula C13H17ClN4OS2 and a molecular weight of 344.89 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-methylpiperazine-1-carbodithioate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-methylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 9456891 |
| Molecular Formula | C13H17ClN4OS2 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-methylpiperazine-1-carbodithioate |
| SMILES | CN1CCN(C(=S)SCC(=O)Nc2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C13H17ClN4OS2/c1-17-4-6-18(7-5-17)13(20)21-9-12(19)16-11-3-2-10(14)8-15-11/h2-3,8H,4-7,9H2,1H3,(H,15,16,19) |
| InChIKey | UFCUYXZHYYLAFS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|